C13H22N2O2S2 — CID 167894284
N-[1-(4-ethyl-1,3-thiazol-2-yl)ethyl]hex-5-ene-1-sulfonamide (PubChem CID 167894284) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[1-(4-ethyl-1,3-thiazol-2-yl)ethyl]hex-5-ene-1-sulfonamide.
| Compound Name | N-[1-(4-ethyl-1,3-thiazol-2-yl)ethyl]hex-5-ene-1-sulfonamide |
|---|---|
| PubChem CID | 167894284 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[1-(4-ethyl-1,3-thiazol-2-yl)ethyl]hex-5-ene-1-sulfonamide |
| SMILES | C=CCCCCS(=O)(=O)NC(C)c1nc(CC)cs1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-4-6-7-8-9-19(16,17)15-11(3)13-14-12(5-2)10-18-13/h4,10-11,15H,1,5-9H2,2-3H3 |
| InChIKey | BPHJCJDQRJYALP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|