C24H27N5O2 — CID 167910233
1-[[3-[(5-benzyl-1H-pyrazole-3-carbonyl)amino]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 167910233) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[[3-[(5-benzyl-1H-pyrazole-3-carbonyl)amino]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[(5-benzyl-1H-pyrazole-3-carbonyl)amino]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 167910233 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-[[3-[(5-benzyl-1H-pyrazole-3-carbonyl)amino]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(Cc2cccc(NC(=O)c3cc(Cc4ccccc4)[nH]n3)c2)C1 |
| InChI | InChI=1S/C24H27N5O2/c25-23(30)19-9-5-11-29(16-19)15-18-8-4-10-20(13-18)26-24(31)22-14-21(27-28-22)12-17-6-2-1-3-7-17/h1-4,6-8,10,13-14,19H,5,9,11-12,15-16H2,(H2,25,30)(H,26,31)(H,27,28) |
| InChIKey | AKQOHYMTWFQFNI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |