C16H17N5O4 — CID 167917711
3-[2-(benzimidazol-1-yl)ethyl]-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 167917711) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-[2-(benzimidazol-1-yl)ethyl]-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(benzimidazol-1-yl)ethyl]-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167917711 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-[2-(benzimidazol-1-yl)ethyl]-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NCC(CN2CC(=O)N(CCn3cnc4ccccc43)C2=O)O1 |
| InChI | InChI=1S/C16H17N5O4/c22-14-9-20(8-11-7-17-15(23)25-11)16(24)21(14)6-5-19-10-18-12-3-1-2-4-13(12)19/h1-4,10-11H,5-9H2,(H,17,23) |
| InChIKey | XVQKDFUVPPMOOG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|