C22H24N2O4 — CID 18348638
7-[2-(benzimidazol-1-yl)ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione (PubChem CID 18348638) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 7-[2-(benzimidazol-1-yl)ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione.
| Compound Name | 7-[2-(benzimidazol-1-yl)ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione |
|---|---|
| PubChem CID | 18348638 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 7-[2-(benzimidazol-1-yl)ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C2=C(CCC(CCn3cnc4ccccc43)CC2)C1=O |
| InChI | InChI=1S/C22H24N2O4/c1-27-21-19(25)15-9-7-14(8-10-16(15)20(26)22(21)28-2)11-12-24-13-23-17-5-3-4-6-18(17)24/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | CJNNGURGSNURID-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|