C19H26N4O3 — CID 167922474
1-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea (PubChem CID 167922474) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea.
| Compound Name | 1-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 167922474 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
| SMILES | Cc1[nH]ncc1CCCNC(=O)NC(C)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H26N4O3/c1-13(15-6-7-17-18(11-15)26-10-4-9-25-17)22-19(24)20-8-3-5-16-12-21-23-14(16)2/h6-7,11-13H,3-5,8-10H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | AKBOLDYPLGMJQP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|