C10H12N2O8S2 — CID 167931892
5-[[2-(carboxymethylamino)-2-oxoethyl]sulfamoyl]-4-methoxythiophene-2-carboxylic acid (PubChem CID 167931892) has the molecular formula C10H12N2O8S2 and a molecular weight of 352.35 g/mol. Its IUPAC name is 5-[[2-(carboxymethylamino)-2-oxoethyl]sulfamoyl]-4-methoxythiophene-2-carboxylic acid.
| Compound Name | 5-[[2-(carboxymethylamino)-2-oxoethyl]sulfamoyl]-4-methoxythiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 167931892 |
| Molecular Formula | C10H12N2O8S2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 5-[[2-(carboxymethylamino)-2-oxoethyl]sulfamoyl]-4-methoxythiophene-2-carboxylic acid |
| SMILES | COc1cc(C(=O)O)sc1S(=O)(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C10H12N2O8S2/c1-20-5-2-6(9(16)17)21-10(5)22(18,19)12-3-7(13)11-4-8(14)15/h2,12H,3-4H2,1H3,(H,11,13)(H,14,15)(H,16,17) |
| InChIKey | VSZLFUGJJLBQTB-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |