C11H15ClF3N3O2S — CID 167932026
1-pyridin-3-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine;hydrochloride (PubChem CID 167932026) has the molecular formula C11H15ClF3N3O2S and a molecular weight of 345.77 g/mol. Its IUPAC name is 1-pyridin-3-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine;hydrochloride.
| Compound Name | 1-pyridin-3-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 167932026 |
| Molecular Formula | C11H15ClF3N3O2S |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 1-pyridin-3-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCC(C(F)(F)F)N(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C11H14F3N3O2S.ClH/c12-11(13,14)10-4-3-8(15)7-17(10)20(18,19)9-2-1-5-16-6-9;/h1-2,5-6,8,10H,3-4,7,15H2;1H |
| InChIKey | KWVVRQMYWHUFPD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |