C10H13F3N2O2S2 — CID 129433921
(3S,6S)-1-thiophen-2-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine (PubChem CID 129433921) has the molecular formula C10H13F3N2O2S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is (3S,6S)-1-thiophen-2-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine.
| Compound Name | (3S,6S)-1-thiophen-2-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 129433921 |
| Molecular Formula | C10H13F3N2O2S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | (3S,6S)-1-thiophen-2-ylsulfonyl-6-(trifluoromethyl)piperidin-3-amine |
| SMILES | N[C@H]1CC[C@@H](C(F)(F)F)N(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C10H13F3N2O2S2/c11-10(12,13)8-4-3-7(14)6-15(8)19(16,17)9-2-1-5-18-9/h1-2,5,7-8H,3-4,6,14H2/t7-,8-/m0/s1 |
| InChIKey | VINAKOLLBDXUOF-YUMQZZPRSA-N |
| XLogP | 1.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |