C17H19N3O4S — CID 167950722
N-(5,6-dimethoxy-3-pyridinyl)-1,2-dimethylindole-3-sulfonamide (PubChem CID 167950722) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-pyridinyl)-1,2-dimethylindole-3-sulfonamide.
| Compound Name | N-(5,6-dimethoxy-3-pyridinyl)-1,2-dimethylindole-3-sulfonamide |
|---|---|
| PubChem CID | 167950722 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-(5,6-dimethoxy-3-pyridinyl)-1,2-dimethylindole-3-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2c(C)n(C)c3ccccc23)cnc1OC |
| InChI | InChI=1S/C17H19N3O4S/c1-11-16(13-7-5-6-8-14(13)20(11)2)25(21,22)19-12-9-15(23-3)17(24-4)18-10-12/h5-10,19H,1-4H3 |
| InChIKey | GYLXDBCDEXRUJO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |