C10H15NO5S2 — CID 167953223
2-[(4,5-dimethylthiophen-2-yl)sulfonylamino]oxy-2-methylpropanoic acid (PubChem CID 167953223) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[(4,5-dimethylthiophen-2-yl)sulfonylamino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(4,5-dimethylthiophen-2-yl)sulfonylamino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 167953223 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[(4,5-dimethylthiophen-2-yl)sulfonylamino]oxy-2-methylpropanoic acid |
| SMILES | Cc1cc(S(=O)(=O)NOC(C)(C)C(=O)O)sc1C |
| InChI | InChI=1S/C10H15NO5S2/c1-6-5-8(17-7(6)2)18(14,15)11-16-10(3,4)9(12)13/h5,11H,1-4H3,(H,12,13) |
| InChIKey | CMJPQRBWJFZLII-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|