C17H12N2O — CID 167958007
6-pyrazolo[1,5-a]pyridin-6-ylnaphthalen-2-ol (PubChem CID 167958007) has the molecular formula C17H12N2O and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-pyrazolo[1,5-a]pyridin-6-ylnaphthalen-2-ol.
| Compound Name | 6-pyrazolo[1,5-a]pyridin-6-ylnaphthalen-2-ol |
|---|---|
| PubChem CID | 167958007 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 6-pyrazolo[1,5-a]pyridin-6-ylnaphthalen-2-ol |
| SMILES | Oc1ccc2cc(-c3ccc4ccnn4c3)ccc2c1 |
| InChI | InChI=1S/C17H12N2O/c20-17-6-4-12-9-13(1-2-14(12)10-17)15-3-5-16-7-8-18-19(16)11-15/h1-11,20H |
| InChIKey | MFCDNFAKPQAVLX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |