C16H31N3 — CID 167968196
6-methyl-N-(6-methylheptan-2-yl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 167968196) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 6-methyl-N-(6-methylheptan-2-yl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | 6-methyl-N-(6-methylheptan-2-yl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 167968196 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 6-methyl-N-(6-methylheptan-2-yl)-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | CC(C)CCCC(C)NC1=NCC2CCC(C)CN12 |
| InChI | InChI=1S/C16H31N3/c1-12(2)6-5-7-14(4)18-16-17-10-15-9-8-13(3)11-19(15)16/h12-15H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | JWPVRUBDLGIBFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |