C10H18FN3 — CID 166305633
N-(2-fluoroethyl)-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 166305633) has the molecular formula C10H18FN3 and a molecular weight of 199.27 g/mol. Its IUPAC name is N-(2-fluoroethyl)-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | N-(2-fluoroethyl)-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 166305633 |
| Molecular Formula | C10H18FN3 |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | N-(2-fluoroethyl)-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | CC1CCC2CN=C(NCCF)N2C1 |
| InChI | InChI=1S/C10H18FN3/c1-8-2-3-9-6-13-10(12-5-4-11)14(9)7-8/h8-9H,2-7H2,1H3,(H,12,13) |
| InChIKey | CIXXPVRCFWDDCG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |