C22H23N3O5 — CID 16797385
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-(diethylamino)-5-nitrobenzoate (PubChem CID 16797385) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-(diethylamino)-5-nitrobenzoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-(diethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 16797385 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-(diethylamino)-5-nitrobenzoate |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])cc1C(=O)OCc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C22H23N3O5/c1-4-24(5-2)20-12-11-17(25(27)28)13-18(20)22(26)29-14-19-15(3)30-21(23-19)16-9-7-6-8-10-16/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | CRTLGBHNTVAWMJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|