C18H17N3O5S — CID 41479471
(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 41479471) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 41479471 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | Cc1oc(-c2cccs2)nc1COC(=O)c1cc([N+](=O)[O-])ccc1N(C)C |
| InChI | InChI=1S/C18H17N3O5S/c1-11-14(19-17(26-11)16-5-4-8-27-16)10-25-18(22)13-9-12(21(23)24)6-7-15(13)20(2)3/h4-9H,10H2,1-3H3 |
| InChIKey | MDDSPUMGKLAYEX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|