C16H11N3O3S2 — CID 167979237
N-(2-oxo-1H-quinolin-5-yl)-1,3-benzothiazole-5-sulfonamide (PubChem CID 167979237) has the molecular formula C16H11N3O3S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is N-(2-oxo-1H-quinolin-5-yl)-1,3-benzothiazole-5-sulfonamide.
| Compound Name | N-(2-oxo-1H-quinolin-5-yl)-1,3-benzothiazole-5-sulfonamide |
|---|---|
| PubChem CID | 167979237 |
| Molecular Formula | C16H11N3O3S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-(2-oxo-1H-quinolin-5-yl)-1,3-benzothiazole-5-sulfonamide |
| SMILES | O=c1ccc2c(NS(=O)(=O)c3ccc4scnc4c3)cccc2[nH]1 |
| InChI | InChI=1S/C16H11N3O3S2/c20-16-7-5-11-12(18-16)2-1-3-13(11)19-24(21,22)10-4-6-15-14(8-10)17-9-23-15/h1-9,19H,(H,18,20) |
| InChIKey | PLJBONAKNAZXNA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |