C22H15N3O3S2 — CID 154863535
N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 154863535) has the molecular formula C22H15N3O3S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 154863535 |
| Molecular Formula | C22H15N3O3S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)Nc3nc(-c4cccc5ccccc45)cs3)ccc2[nH]1 |
| InChI | InChI=1S/C22H15N3O3S2/c26-21-11-8-15-12-16(9-10-19(15)23-21)30(27,28)25-22-24-20(13-29-22)18-7-3-5-14-4-1-2-6-17(14)18/h1-13H,(H,23,26)(H,24,25) |
| InChIKey | JHZTWKPHQWVVJT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|