C17H21BrN2O3 — CID 167987475
methyl 3-bromo-4-(6-hydroxyhexylamino)quinoline-2-carboxylate (PubChem CID 167987475) has the molecular formula C17H21BrN2O3 and a molecular weight of 381.27 g/mol. Its IUPAC name is methyl 3-bromo-4-(6-hydroxyhexylamino)quinoline-2-carboxylate.
| Compound Name | methyl 3-bromo-4-(6-hydroxyhexylamino)quinoline-2-carboxylate |
|---|---|
| PubChem CID | 167987475 |
| Molecular Formula | C17H21BrN2O3 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | methyl 3-bromo-4-(6-hydroxyhexylamino)quinoline-2-carboxylate |
| SMILES | COC(=O)c1nc2ccccc2c(NCCCCCCO)c1Br |
| InChI | InChI=1S/C17H21BrN2O3/c1-23-17(22)16-14(18)15(19-10-6-2-3-7-11-21)12-8-4-5-9-13(12)20-16/h4-5,8-9,21H,2-3,6-7,10-11H2,1H3,(H,19,20) |
| InChIKey | DJURMBCWXLOIEQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|