C23H18N4OS — CID 167992800
5-(1,3-benzothiazol-5-yl)-N-benzyl-N-methyl-1H-indazole-3-carboxamide (PubChem CID 167992800) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-5-yl)-N-benzyl-N-methyl-1H-indazole-3-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-5-yl)-N-benzyl-N-methyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 167992800 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-(1,3-benzothiazol-5-yl)-N-benzyl-N-methyl-1H-indazole-3-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1n[nH]c2ccc(-c3ccc4scnc4c3)cc12 |
| InChI | InChI=1S/C23H18N4OS/c1-27(13-15-5-3-2-4-6-15)23(28)22-18-11-16(7-9-19(18)25-26-22)17-8-10-21-20(12-17)24-14-29-21/h2-12,14H,13H2,1H3,(H,25,26) |
| InChIKey | XHNCULJYVHSVOU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |