C13H19N5O3 — CID 167999076
1,3-dimethyl-8-(3-propan-2-yloxypropylimino)purine-2,6-dione (PubChem CID 167999076) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1,3-dimethyl-8-(3-propan-2-yloxypropylimino)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(3-propan-2-yloxypropylimino)purine-2,6-dione |
|---|---|
| PubChem CID | 167999076 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1,3-dimethyl-8-(3-propan-2-yloxypropylimino)purine-2,6-dione |
| SMILES | CC(C)OCCC/N=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C13H19N5O3/c1-8(2)21-7-5-6-14-12-15-9-10(16-12)17(3)13(20)18(4)11(9)19/h8H,5-7H2,1-4H3/b14-12+ |
| InChIKey | FBRPRKURDINXCF-WYMLVPIESA-N |
| XLogP | -1.49 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|