C11H16N5O3+ — CID 74415293
(1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methoxypropyl)azanium (PubChem CID 74415293) has the molecular formula C11H16N5O3+ and a molecular weight of 266.28 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methoxypropyl)azanium.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 74415293 |
| Molecular Formula | C11H16N5O3+ |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methoxypropyl)azanium |
| SMILES | COCCC/[NH+]=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C11H15N5O3/c1-15-8-7(9(17)16(2)11(15)18)13-10(14-8)12-5-4-6-19-3/h4-6H2,1-3H3/p+1/b12-10+ |
| InChIKey | AMAUVNJDBMFXOW-ZRDIBKRKSA-O |
| XLogP | -4.19 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|