C13H20N5O3+ — CID 78202904
(1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-propan-2-yloxypropyl)azanium (PubChem CID 78202904) has the molecular formula C13H20N5O3+ and a molecular weight of 294.34 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-propan-2-yloxypropyl)azanium.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-propan-2-yloxypropyl)azanium |
|---|---|
| PubChem CID | 78202904 |
| Molecular Formula | C13H20N5O3+ |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-propan-2-yloxypropyl)azanium |
| SMILES | CC(C)OCCC/[NH+]=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C13H19N5O3/c1-8(2)21-7-5-6-14-12-15-9-10(16-12)17(3)13(20)18(4)11(9)19/h8H,5-7H2,1-4H3/p+1/b14-12+ |
| InChIKey | FBRPRKURDINXCF-WYMLVPIESA-O |
| XLogP | -3.41 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|