C12H18N5O2+ — CID 78209478
(1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methylbutyl)azanium (PubChem CID 78209478) has the molecular formula C12H18N5O2+ and a molecular weight of 264.31 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methylbutyl)azanium.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methylbutyl)azanium |
|---|---|
| PubChem CID | 78209478 |
| Molecular Formula | C12H18N5O2+ |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-(3-methylbutyl)azanium |
| SMILES | CC(C)CC/[NH+]=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C12H17N5O2/c1-7(2)5-6-13-11-14-8-9(15-11)16(3)12(19)17(4)10(8)18/h7H,5-6H2,1-4H3/p+1/b13-11+ |
| InChIKey | YZALIZKMTKTFDF-ACCUITESSA-O |
| XLogP | -3.18 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|