C8H6N4O4 — CID 86280395
1,3-dimethylpteridine-2,4,6,7-tetrone (PubChem CID 86280395) has the molecular formula C8H6N4O4 and a molecular weight of 222.16 g/mol. Its IUPAC name is 1,3-dimethylpteridine-2,4,6,7-tetrone.
| Compound Name | 1,3-dimethylpteridine-2,4,6,7-tetrone |
|---|---|
| PubChem CID | 86280395 |
| Molecular Formula | C8H6N4O4 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 1,3-dimethylpteridine-2,4,6,7-tetrone |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=O)C(=O)N=2 |
| InChI | InChI=1S/C8H6N4O4/c1-11-4-3(7(15)12(2)8(11)16)9-5(13)6(14)10-4/h1-2H3 |
| InChIKey | JJBLMVWEHVKMOP-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 102.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|