C15H23N6O2+ — CID 167999129
7-hexyl-3,9-dimethyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167999129) has the molecular formula C15H23N6O2+ and a molecular weight of 319.39 g/mol. Its IUPAC name is 7-hexyl-3,9-dimethyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 7-hexyl-3,9-dimethyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167999129 |
| Molecular Formula | C15H23N6O2+ |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 7-hexyl-3,9-dimethyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CCCCCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3)N(C)C1=O |
| InChI | InChI=1S/C15H22N6O2/c1-4-5-6-7-8-20-13(22)11-12(19(3)15(20)23)16-14-18-17-10(2)9-21(11)14/h11H,4-9H2,1-3H3/p+1 |
| InChIKey | URQADWAGSPMCNP-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|