C15H22N7O3+ — CID 167999440
2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide (PubChem CID 167999440) has the molecular formula C15H22N7O3+ and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide.
| Compound Name | 2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 167999440 |
| Molecular Formula | C15H22N7O3+ |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-(7-butyl-3,9-dimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide |
| SMILES | CCCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C15H21N7O3/c1-4-5-6-20-13(24)11-12(19(3)15(20)25)17-14-21(11)7-9(2)18-22(14)8-10(16)23/h11H,4-8H2,1-3H3,(H-,16,23)/p+1 |
| InChIKey | LFAKPBFKPWADSU-UHFFFAOYSA-O |
| XLogP | -0.99 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|