C16H24N7O3+ — CID 167999447
2-(3,9-dimethyl-6,8-dioxo-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide (PubChem CID 167999447) has the molecular formula C16H24N7O3+ and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-(3,9-dimethyl-6,8-dioxo-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide.
| Compound Name | 2-(3,9-dimethyl-6,8-dioxo-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 167999447 |
| Molecular Formula | C16H24N7O3+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-(3,9-dimethyl-6,8-dioxo-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetamide |
| SMILES | CCCCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C16H23N7O3/c1-4-5-6-7-21-14(25)12-13(20(3)16(21)26)18-15-22(12)8-10(2)19-23(15)9-11(17)24/h12H,4-9H2,1-3H3,(H-,17,24)/p+1 |
| InChIKey | ZIDAKJUKKKHVCL-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|