C16H17NO — CID 168500161
4-ethynyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidin-2-one (PubChem CID 168500161) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-ethynyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168500161 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-ethynyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N([C@H]2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C16H17NO/c1-2-12-10-16(18)17(11-12)15-9-5-7-13-6-3-4-8-14(13)15/h1,3-4,6,8,12,15H,5,7,9-11H2/t12?,15-/m0/s1 |
| InChIKey | KKWCYQVTHIBXNR-CVRLYYSRSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|