C9H12BrF3N2O2 — CID 168504856
2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 168504856) has the molecular formula C9H12BrF3N2O2 and a molecular weight of 317.11 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 168504856 |
| Molecular Formula | C9H12BrF3N2O2 |
| Molecular Weight | 317.11 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1CC(CBr)CC1=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H12BrF3N2O2/c10-2-6-1-8(17)15(3-6)4-7(16)14-5-9(11,12)13/h6H,1-5H2,(H,14,16) |
| InChIKey | MVNYEVQITYBDBQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.11 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|