C11H10Cl2N4O — CID 168509714
4-(chloromethyl)-1-(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)pyrrolidin-2-one (PubChem CID 168509714) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168509714 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4-(chloromethyl)-1-(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1c1nc2ccc(Cl)cn2n1 |
| InChI | InChI=1S/C11H10Cl2N4O/c12-4-7-3-10(18)16(5-7)11-14-9-2-1-8(13)6-17(9)15-11/h1-2,6-7H,3-5H2 |
| InChIKey | QJSOJIBQZCTCJQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|