C13H17F2NO2 — CID 168514547
1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]pyrrolidine (PubChem CID 168514547) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is 1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]pyrrolidine.
| Compound Name | 1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]pyrrolidine |
|---|---|
| PubChem CID | 168514547 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]pyrrolidine |
| SMILES | COc1cc(N2CCCC2)ccc1OCC(F)F |
| InChI | InChI=1S/C13H17F2NO2/c1-17-12-8-10(16-6-2-3-7-16)4-5-11(12)18-9-13(14)15/h4-5,8,13H,2-3,6-7,9H2,1H3 |
| InChIKey | NCRPPWRBERXAIR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|