C16H8Br2ClNO4 — CID 168516487
methyl 2,6-dibromo-4-chloro-3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 168516487) has the molecular formula C16H8Br2ClNO4 and a molecular weight of 473.50 g/mol. Its IUPAC name is methyl 2,6-dibromo-4-chloro-3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | methyl 2,6-dibromo-4-chloro-3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 168516487 |
| Molecular Formula | C16H8Br2ClNO4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 470.85 |
| IUPAC Name | methyl 2,6-dibromo-4-chloro-3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | COC(=O)c1c(Br)cc(Cl)c(N2C(=O)c3ccccc3C2=O)c1Br |
| InChI | InChI=1S/C16H8Br2ClNO4/c1-24-16(23)11-9(17)6-10(19)13(12(11)18)20-14(21)7-4-2-3-5-8(7)15(20)22/h2-6H,1H3 |
| InChIKey | DSVKFELUQJQUHF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|