C10H10N4O2S — CID 168534975
[(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea (PubChem CID 168534975) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea.
| Compound Name | [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 168534975 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H10N4O2S/c11-10(17)14-12-4-6-1-2-8-7(3-6)13-9(15)5-16-8/h1-4H,5H2,(H,13,15)(H3,11,14,17) |
| InChIKey | JGYRJZYDWDMIAC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|