About [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea
[(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea (PubChem CID 168534975) has the molecular formula C10H10N4O2S
and a molecular weight of 250.28 g/mol. Its IUPAC name is [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea |
| PubChem CID | 168534975 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H10N4O2S/c11-10(17)14-12-4-6-1-2-8-7(3-6)13-9(15)5-16-8/h1-4H,5H2,(H,13,15)(H3,11,14,17) |
| InChIKey | JGYRJZYDWDMIAC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea?
The IUPAC name of [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea (CID 168534975) is [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea.
What is the SMILES notation for [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea?
The canonical SMILES for [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea is NC(=S)NN=Cc1ccc2c(c1)NC(=O)CO2.
What is the InChIKey of [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea?
The InChIKey is JGYRJZYDWDMIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S/c11-10(17)14-12-4-6-1-2-8-7(3-6)13-9(15)5-16-8/h1-4H,5H2,(H,13,15)(H3,11,14,17).
What are the key properties of [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea?
[(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea has a molecular weight of 250.28 g/mol, XLogP of 0.18, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-oxo-4H-1,4-benzoxazin-6-yl)methylideneamino]thiourea is sourced from PubChem (CID 168534975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).