C17H20N4O2S — CID 168545574
2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]methylidene]propanedinitrile (PubChem CID 168545574) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168545574 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[[4-(3,5-dimethylpiperidin-1-yl)sulfonylanilino]methylidene]propanedinitrile |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(NC=C(C#N)C#N)cc2)C1 |
| InChI | InChI=1S/C17H20N4O2S/c1-13-7-14(2)12-21(11-13)24(22,23)17-5-3-16(4-6-17)20-10-15(8-18)9-19/h3-6,10,13-14,20H,7,11-12H2,1-2H3 |
| InChIKey | GWMSZDWWEDJTIH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|