C27H25N5O2S — CID 17134961
2-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylanilino]methylidene]propanedinitrile (PubChem CID 17134961) has the molecular formula C27H25N5O2S and a molecular weight of 483.60 g/mol. Its IUPAC name is 2-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 17134961 |
| Molecular Formula | C27H25N5O2S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[[4-(4-benzhydrylpiperazin-1-yl)sulfonylanilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H25N5O2S/c28-19-22(20-29)21-30-25-11-13-26(14-12-25)35(33,34)32-17-15-31(16-18-32)27(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-14,21,27,30H,15-18H2 |
| InChIKey | IEQJTVUSNYLZJA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|