C18H20N4O5S — CID 168548629
methyl 3-amino-4-cyano-1-(4-methyl-3-morpholin-4-ylsulfonylphenyl)pyrrole-2-carboxylate (PubChem CID 168548629) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(4-methyl-3-morpholin-4-ylsulfonylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(4-methyl-3-morpholin-4-ylsulfonylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548629 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(4-methyl-3-morpholin-4-ylsulfonylphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H20N4O5S/c1-12-3-4-14(9-15(12)28(24,25)21-5-7-27-8-6-21)22-11-13(10-19)16(20)17(22)18(23)26-2/h3-4,9,11H,5-8,20H2,1-2H3 |
| InChIKey | SIDHJOOSHBLXNV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |