C16H13N5O3 — CID 168549431
methyl 3-amino-4-cyano-1-(3-methyl-4-oxoquinazolin-6-yl)pyrrole-2-carboxylate (PubChem CID 168549431) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(3-methyl-4-oxoquinazolin-6-yl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(3-methyl-4-oxoquinazolin-6-yl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549431 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(3-methyl-4-oxoquinazolin-6-yl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc2ncn(C)c(=O)c2c1 |
| InChI | InChI=1S/C16H13N5O3/c1-20-8-19-12-4-3-10(5-11(12)15(20)22)21-7-9(6-17)13(18)14(21)16(23)24-2/h3-5,7-8H,18H2,1-2H3 |
| InChIKey | WVCFJTVWQNUVIV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |