C16H15BrN4O3 — CID 168559639
3-[4-[(4-bromopyrazol-1-yl)methyl]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559639) has the molecular formula C16H15BrN4O3 and a molecular weight of 391.23 g/mol. Its IUPAC name is 3-[4-[(4-bromopyrazol-1-yl)methyl]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[4-[(4-bromopyrazol-1-yl)methyl]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559639 |
| Molecular Formula | C16H15BrN4O3 |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 3-[4-[(4-bromopyrazol-1-yl)methyl]anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(Cn3cc(Br)cn3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C16H15BrN4O3/c17-12-8-18-20(10-12)9-11-1-3-13(4-2-11)19-14-7-15(23)21(5-6-22)16(14)24/h1-4,7-8,10,19,22H,5-6,9H2 |
| InChIKey | YBQVTURLUVKAJX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|