C16H17N5O4 — CID 168561876
methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(triazol-1-yl)anilino]-2H-pyrrole-3-carboxylate (PubChem CID 168561876) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(triazol-1-yl)anilino]-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(triazol-1-yl)anilino]-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561876 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(triazol-1-yl)anilino]-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(-n3ccnn3)cc2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C16H17N5O4/c1-25-16(24)13-10-20(8-9-22)15(23)14(13)18-11-2-4-12(5-3-11)21-7-6-17-19-21/h2-7,18,22H,8-10H2,1H3 |
| InChIKey | GYVJCOWQFRPJTQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |