C25H25N3O6S — CID 168567399
dimethyl (E)-2-[4-[(4,6-dimethoxypyrimidin-2-yl)-phenylmethyl]sulfanylanilino]but-2-enedioate (PubChem CID 168567399) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[(4,6-dimethoxypyrimidin-2-yl)-phenylmethyl]sulfanylanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[(4,6-dimethoxypyrimidin-2-yl)-phenylmethyl]sulfanylanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567399 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | dimethyl (E)-2-[4-[(4,6-dimethoxypyrimidin-2-yl)-phenylmethyl]sulfanylanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(SC(c2ccccc2)c2nc(OC)cc(OC)n2)cc1)C(=O)OC |
| InChI | InChI=1S/C25H25N3O6S/c1-31-20-15-21(32-2)28-24(27-20)23(16-8-6-5-7-9-16)35-18-12-10-17(11-13-18)26-19(25(30)34-4)14-22(29)33-3/h5-15,23,26H,1-4H3/b19-14+ |
| InChIKey | GCNOUYDRTAHVSB-XMHGGMMESA-N |
| XLogP | 4.02 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|