C16H20BNO8 — CID 168569004
[2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4-propan-2-yloxycarbonylphenyl]boronic acid (PubChem CID 168569004) has the molecular formula C16H20BNO8 and a molecular weight of 365.15 g/mol. Its IUPAC name is [2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4-propan-2-yloxycarbonylphenyl]boronic acid.
| Compound Name | [2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4-propan-2-yloxycarbonylphenyl]boronic acid |
|---|---|
| PubChem CID | 168569004 |
| Molecular Formula | C16H20BNO8 |
| Molecular Weight | 365.15 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-4-propan-2-yloxycarbonylphenyl]boronic acid |
| SMILES | COC(=O)/C=C(/Nc1cc(C(=O)OC(C)C)ccc1B(O)O)C(=O)OC |
| InChI | InChI=1S/C16H20BNO8/c1-9(2)26-15(20)10-5-6-11(17(22)23)12(7-10)18-13(16(21)25-4)8-14(19)24-3/h5-9,18,22-23H,1-4H3/b13-8+ |
| InChIKey | PTEFQKTYHTXVRB-MDWZMJQESA-N |
| XLogP | -0.43 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|