C23H24N4O3S — CID 168579354
N-(oxolan-2-ylmethyl)-2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 168579354) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 168579354 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1)NCC1CCCO1 |
| InChI | InChI=1S/C23H24N4O3S/c28-22(24-14-20-7-4-12-29-20)15-30-19-10-8-17(9-11-19)13-25-27-23-26-21(16-31-23)18-5-2-1-3-6-18/h1-3,5-6,8-11,13,16,20H,4,7,12,14-15H2,(H,24,28)(H,26,27) |
| InChIKey | BGBFPRIBUNRUOP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|