C16H19ClN2OS — CID 168583349
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-cyclohexyloxyaniline (PubChem CID 168583349) has the molecular formula C16H19ClN2OS and a molecular weight of 322.86 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-cyclohexyloxyaniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-cyclohexyloxyaniline |
|---|---|
| PubChem CID | 168583349 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-cyclohexyloxyaniline |
| SMILES | Clc1ncc(CNc2ccccc2OC2CCCCC2)s1 |
| InChI | InChI=1S/C16H19ClN2OS/c17-16-19-11-13(21-16)10-18-14-8-4-5-9-15(14)20-12-6-2-1-3-7-12/h4-5,8-9,11-12,18H,1-3,6-7,10H2 |
| InChIKey | AQRQDUIYFNPNJS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |