C12H8N4O5S — CID 168588896
4-(3,4-dihydroxy-5-nitrophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588896) has the molecular formula C12H8N4O5S and a molecular weight of 320.29 g/mol. Its IUPAC name is 4-(3,4-dihydroxy-5-nitrophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3,4-dihydroxy-5-nitrophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588896 |
| Molecular Formula | C12H8N4O5S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-(3,4-dihydroxy-5-nitrophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(O)c(O)c([N+](=O)[O-])c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H8N4O5S/c1-22-12-14-9(6(4-13)11(19)15-12)5-2-7(16(20)21)10(18)8(17)3-5/h2-3,17-18H,1H3,(H,14,15,19) |
| InChIKey | GPVPKBDRYKLJOW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|