C20H15BrN4OS — CID 168590118
4-(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168590118) has the molecular formula C20H15BrN4OS and a molecular weight of 439.34 g/mol. Its IUPAC name is 4-(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168590118 |
| Molecular Formula | C20H15BrN4OS |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 4-(6-bromo-1,4-dimethyl-9H-carbazol-3-yl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(C)c3[nH]c4ccc(Br)cc4c3c2C)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H15BrN4OS/c1-9-6-12(18-14(8-22)19(26)25-20(24-18)27-3)10(2)16-13-7-11(21)4-5-15(13)23-17(9)16/h4-7,23H,1-3H3,(H,24,25,26) |
| InChIKey | MKSPUYBGPSOHEB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|