About methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate
methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate (PubChem CID 168596031) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate |
| PubChem CID | 168596031 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(NCC(O)CO)c2)n[nH]1 |
| InChI | InChI=1S/C14H17N3O4/c1-21-14(20)13-6-12(16-17-13)9-3-2-4-10(5-9)15-7-11(19)8-18/h2-6,11,15,18-19H,7-8H2,1H3,(H,16,17) |
| InChIKey | FTVOJGYIMLHGIS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate?
The IUPAC name of methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate (CID 168596031) is methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate.
What is the SMILES notation for methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate?
The canonical SMILES for methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate is COC(=O)c1cc(-c2cccc(NCC(O)CO)c2)n[nH]1.
What is the InChIKey of methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate?
The InChIKey is FTVOJGYIMLHGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O4/c1-21-14(20)13-6-12(16-17-13)9-3-2-4-10(5-9)15-7-11(19)8-18/h2-6,11,15,18-19H,7-8H2,1H3,(H,16,17).
What are the key properties of methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate?
methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate has a molecular weight of 291.31 g/mol, XLogP of 0.63, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-(2,3-dihydroxypropylamino)phenyl]-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 168596031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).