About methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate
methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate (PubChem CID 168596645) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate.
Analyze methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate?
The IUPAC name of methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate (CID 168596645) is methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate.
What is the SMILES notation for methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate?
The canonical SMILES for methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate is COC(=O)Cc1cccc(OC)c1NCC(O)CO.
What is the InChIKey of methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate?
The InChIKey is FUJFBADKBDVIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5/c1-18-11-5-3-4-9(6-12(17)19-2)13(11)14-7-10(16)8-15/h3-5,10,14-16H,6-8H2,1-2H3.
What are the key properties of methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate?
methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate has a molecular weight of 269.30 g/mol, XLogP of 0.18, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2,3-dihydroxypropylamino)-3-methoxyphenyl]acetate is sourced from PubChem (CID 168596645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).