C16H24N6O2 — CID 168605461
tert-butyl 6-[[amino-(diaminomethylideneamino)methylidene]amino]-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 168605461) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is tert-butyl 6-[[amino-(diaminomethylideneamino)methylidene]amino]-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 6-[[amino-(diaminomethylideneamino)methylidene]amino]-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 168605461 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | tert-butyl 6-[[amino-(diaminomethylideneamino)methylidene]amino]-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2cc(/N=C(\N)N=C(N)N)ccc21 |
| InChI | InChI=1S/C16H24N6O2/c1-16(2,3)24-15(23)22-8-4-5-10-9-11(6-7-12(10)22)20-14(19)21-13(17)18/h6-7,9H,4-5,8H2,1-3H3,(H6,17,18,19,20,21) |
| InChIKey | KFHZUHBSMUCFHV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|