C15H18N4OS — CID 168628052
2-N-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168628052) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-N-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168628052 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-N-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | CC1(C)CCc2cc(C=NNc3nc(N)cs3)ccc2O1 |
| InChI | InChI=1S/C15H18N4OS/c1-15(2)6-5-11-7-10(3-4-12(11)20-15)8-17-19-14-18-13(16)9-21-14/h3-4,7-9H,5-6,16H2,1-2H3,(H,18,19) |
| InChIKey | OFWVRUGVTCAMBA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|