C15H12F5NO8S — CID 168635769
dimethyl 3-[2,4-difluoro-5-(trifluoromethylsulfonyloxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635769) has the molecular formula C15H12F5NO8S and a molecular weight of 461.32 g/mol. Its IUPAC name is dimethyl 3-[2,4-difluoro-5-(trifluoromethylsulfonyloxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2,4-difluoro-5-(trifluoromethylsulfonyloxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635769 |
| Molecular Formula | C15H12F5NO8S |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | dimethyl 3-[2,4-difluoro-5-(trifluoromethylsulfonyloxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(OS(=O)(=O)C(F)(F)F)c(F)cc2F)COC1 |
| InChI | InChI=1S/C15H12F5NO8S/c1-26-13(22)7-5-28-6-21(12(7)14(23)27-2)10-4-11(9(17)3-8(10)16)29-30(24,25)15(18,19)20/h3-4H,5-6H2,1-2H3 |
| InChIKey | MMUFLIOMNVSPPD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|